3-chlorophenyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
Chemical Structure Depiction of
3-chlorophenyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
3-chlorophenyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
Compound characteristics
| Compound ID: | G817-0062 |
| Compound Name: | 3-chlorophenyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate |
| Molecular Weight: | 449.89 |
| Molecular Formula: | C25 H20 Cl N O5 |
| Smiles: | Cc1ccc(cc1)N1C=C(C(=O)Oc2cccc(c2)[Cl])c2cc(c(cc2C1=O)OC)OC |
| Stereo: | ACHIRAL |
| logP: | 5.0536 |
| logD: | 5.0536 |
| logSw: | -5.1024 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 51.393 |
| InChI Key: | MGXZSVZRFOZZOO-UHFFFAOYSA-N |