pentyl 2-(4-methylphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
					Chemical Structure Depiction of
pentyl 2-(4-methylphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
			pentyl 2-(4-methylphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
Compound characteristics
| Compound ID: | G817-0106 | 
| Compound Name: | pentyl 2-(4-methylphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate | 
| Molecular Weight: | 349.43 | 
| Molecular Formula: | C22 H23 N O3 | 
| Smiles: | CCCCCOC(C1=CN(C(c2ccccc12)=O)c1ccc(C)cc1)=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.6574 | 
| logD: | 4.6574 | 
| logSw: | -4.6068 | 
| Hydrogen bond acceptors count: | 5 | 
| Polar surface area: | 36.802 | 
| InChI Key: | LRIUBEJNOXFKCB-UHFFFAOYSA-N | 
 
				 
				