(4-chlorophenyl)methyl 2-(3-methoxyphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
Chemical Structure Depiction of
(4-chlorophenyl)methyl 2-(3-methoxyphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
(4-chlorophenyl)methyl 2-(3-methoxyphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
Compound characteristics
| Compound ID: | G817-0119 |
| Compound Name: | (4-chlorophenyl)methyl 2-(3-methoxyphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate |
| Molecular Weight: | 419.86 |
| Molecular Formula: | C24 H18 Cl N O4 |
| Smiles: | COc1cccc(c1)N1C=C(C(=O)OCc2ccc(cc2)[Cl])c2ccccc2C1=O |
| Stereo: | ACHIRAL |
| logP: | 4.5466 |
| logD: | 4.5466 |
| logSw: | -4.8881 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.156 |
| InChI Key: | MSMYMZXFKBFESJ-UHFFFAOYSA-N |