(3,4-difluorophenyl)methyl 2-(3-methoxyphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
Chemical Structure Depiction of
(3,4-difluorophenyl)methyl 2-(3-methoxyphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
(3,4-difluorophenyl)methyl 2-(3-methoxyphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
Compound characteristics
| Compound ID: | G817-0130 |
| Compound Name: | (3,4-difluorophenyl)methyl 2-(3-methoxyphenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate |
| Molecular Weight: | 421.4 |
| Molecular Formula: | C24 H17 F2 N O4 |
| Smiles: | COc1cccc(c1)N1C=C(C(=O)OCc2ccc(c(c2)F)F)c2ccccc2C1=O |
| Stereo: | ACHIRAL |
| logP: | 4.2273 |
| logD: | 4.2273 |
| logSw: | -4.6491 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.156 |
| InChI Key: | BZMYRLVGEFGYND-UHFFFAOYSA-N |