(4-chlorophenyl)methyl 2-(2-methylpropyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
Chemical Structure Depiction of
(4-chlorophenyl)methyl 2-(2-methylpropyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
(4-chlorophenyl)methyl 2-(2-methylpropyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
Compound characteristics
| Compound ID: | G817-1572 |
| Compound Name: | (4-chlorophenyl)methyl 2-(2-methylpropyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate |
| Molecular Weight: | 369.85 |
| Molecular Formula: | C21 H20 Cl N O3 |
| Smiles: | CC(C)CN1C=C(C(=O)OCc2ccc(cc2)[Cl])c2ccccc2C1=O |
| Stereo: | ACHIRAL |
| logP: | 4.3062 |
| logD: | 4.3062 |
| logSw: | -4.7684 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.329 |
| InChI Key: | CTQQKKDDQJDRIC-UHFFFAOYSA-N |