2-(4-butoxyphenyl)-5-[(2,5-dimethylphenyl)methyl]pyrazolo[1,5-a]pyrazin-4(5H)-one
Chemical Structure Depiction of
2-(4-butoxyphenyl)-5-[(2,5-dimethylphenyl)methyl]pyrazolo[1,5-a]pyrazin-4(5H)-one
2-(4-butoxyphenyl)-5-[(2,5-dimethylphenyl)methyl]pyrazolo[1,5-a]pyrazin-4(5H)-one
Compound characteristics
| Compound ID: | G825-0042 |
| Compound Name: | 2-(4-butoxyphenyl)-5-[(2,5-dimethylphenyl)methyl]pyrazolo[1,5-a]pyrazin-4(5H)-one |
| Molecular Weight: | 401.51 |
| Molecular Formula: | C25 H27 N3 O2 |
| Smiles: | CCCCOc1ccc(cc1)c1cc2C(N(Cc3cc(C)ccc3C)C=Cn2n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.59 |
| logD: | 5.59 |
| logSw: | -5.2376 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 35.388 |
| InChI Key: | YVWIQJBPQIPHLN-UHFFFAOYSA-N |