2-(2-butoxyphenyl)-5-{[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl}pyrazolo[1,5-a]pyrazin-4(5H)-one
Chemical Structure Depiction of
2-(2-butoxyphenyl)-5-{[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl}pyrazolo[1,5-a]pyrazin-4(5H)-one
2-(2-butoxyphenyl)-5-{[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl}pyrazolo[1,5-a]pyrazin-4(5H)-one
Compound characteristics
| Compound ID: | G825-0054 |
| Compound Name: | 2-(2-butoxyphenyl)-5-{[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl}pyrazolo[1,5-a]pyrazin-4(5H)-one |
| Molecular Weight: | 488.97 |
| Molecular Formula: | C27 H25 Cl N4 O3 |
| Smiles: | CCCCOc1ccccc1c1cc2C(N(Cc3c(C)oc(c4ccc(cc4)[Cl])n3)C=Cn2n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2505 |
| logD: | 5.2505 |
| logSw: | -5.5916 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 53.597 |
| InChI Key: | NQSGTQRVIYMBLC-UHFFFAOYSA-N |