2-(4-ethylphenyl)-5-[(3-fluorophenyl)methyl]pyrazolo[1,5-a]pyrazin-4(5H)-one
Chemical Structure Depiction of
2-(4-ethylphenyl)-5-[(3-fluorophenyl)methyl]pyrazolo[1,5-a]pyrazin-4(5H)-one
2-(4-ethylphenyl)-5-[(3-fluorophenyl)methyl]pyrazolo[1,5-a]pyrazin-4(5H)-one
Compound characteristics
| Compound ID: | G825-0521 |
| Compound Name: | 2-(4-ethylphenyl)-5-[(3-fluorophenyl)methyl]pyrazolo[1,5-a]pyrazin-4(5H)-one |
| Molecular Weight: | 347.39 |
| Molecular Formula: | C21 H18 F N3 O |
| Smiles: | CCc1ccc(cc1)c1cc2C(N(Cc3cccc(c3)F)C=Cn2n1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8299 |
| logD: | 3.8299 |
| logSw: | -3.9629 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 27.9706 |
| InChI Key: | XNEGGRFQEFOLCX-UHFFFAOYSA-N |