2-ethyl-N-({3-[(4-fluorophenyl)methyl]-3H-imidazo[4,5-b]pyridin-2-yl}methyl)butanamide
Chemical Structure Depiction of
2-ethyl-N-({3-[(4-fluorophenyl)methyl]-3H-imidazo[4,5-b]pyridin-2-yl}methyl)butanamide
2-ethyl-N-({3-[(4-fluorophenyl)methyl]-3H-imidazo[4,5-b]pyridin-2-yl}methyl)butanamide
Compound characteristics
| Compound ID: | G831-0318 |
| Compound Name: | 2-ethyl-N-({3-[(4-fluorophenyl)methyl]-3H-imidazo[4,5-b]pyridin-2-yl}methyl)butanamide |
| Molecular Weight: | 354.43 |
| Molecular Formula: | C20 H23 F N4 O |
| Smiles: | CCC(CC)C(NCc1nc2cccnc2n1Cc1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.399 |
| logD: | 3.3988 |
| logSw: | -3.3658 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.735 |
| InChI Key: | YSWDJUNFXJHAEH-UHFFFAOYSA-N |