N-[3,5-bis(trifluoromethyl)phenyl]-1-[(4-fluorophenyl)methyl]-2-oxo-1,2-dihydropyridine-3-carboxamide
Chemical Structure Depiction of
N-[3,5-bis(trifluoromethyl)phenyl]-1-[(4-fluorophenyl)methyl]-2-oxo-1,2-dihydropyridine-3-carboxamide
N-[3,5-bis(trifluoromethyl)phenyl]-1-[(4-fluorophenyl)methyl]-2-oxo-1,2-dihydropyridine-3-carboxamide
Compound characteristics
| Compound ID: | G842-0123 |
| Compound Name: | N-[3,5-bis(trifluoromethyl)phenyl]-1-[(4-fluorophenyl)methyl]-2-oxo-1,2-dihydropyridine-3-carboxamide |
| Molecular Weight: | 458.33 |
| Molecular Formula: | C21 H13 F7 N2 O2 |
| Smiles: | C(c1ccc(cc1)F)N1C=CC=C(C(Nc2cc(cc(c2)C(F)(F)F)C(F)(F)F)=O)C1=O |
| Stereo: | ACHIRAL |
| logP: | 4.9929 |
| logD: | 1.3805 |
| logSw: | -4.96 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.044 |
| InChI Key: | LIWPVRKDJGZSCC-UHFFFAOYSA-N |