N-(2,5-difluorophenyl)-1-[(2-methylphenyl)methyl]-2-oxo-1,2-dihydropyridine-3-carboxamide
Chemical Structure Depiction of
N-(2,5-difluorophenyl)-1-[(2-methylphenyl)methyl]-2-oxo-1,2-dihydropyridine-3-carboxamide
N-(2,5-difluorophenyl)-1-[(2-methylphenyl)methyl]-2-oxo-1,2-dihydropyridine-3-carboxamide
Compound characteristics
| Compound ID: | G842-0205 |
| Compound Name: | N-(2,5-difluorophenyl)-1-[(2-methylphenyl)methyl]-2-oxo-1,2-dihydropyridine-3-carboxamide |
| Molecular Weight: | 354.35 |
| Molecular Formula: | C20 H16 F2 N2 O2 |
| Smiles: | Cc1ccccc1CN1C=CC=C(C(Nc2cc(ccc2F)F)=O)C1=O |
| Stereo: | ACHIRAL |
| logP: | 4.1638 |
| logD: | 1.5977 |
| logSw: | -4.2109 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.346 |
| InChI Key: | LPJXGMJAUKESPS-UHFFFAOYSA-N |