N-(5,6-dihydro[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)-2-(3-methylphenyl)acetamide
Chemical Structure Depiction of
N-(5,6-dihydro[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)-2-(3-methylphenyl)acetamide
N-(5,6-dihydro[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)-2-(3-methylphenyl)acetamide
Compound characteristics
| Compound ID: | G844-0274 |
| Compound Name: | N-(5,6-dihydro[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)-2-(3-methylphenyl)acetamide |
| Molecular Weight: | 274.34 |
| Molecular Formula: | C13 H14 N4 O S |
| Smiles: | Cc1cccc(CC(Nc2nnc3n2CCS3)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 1.9372 |
| logD: | 1.9365 |
| logSw: | -2.5738 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.247 |
| InChI Key: | DOIYJVGBLTVMIV-UHFFFAOYSA-N |