N-(6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3]thiazin-3-yl)-2-(2-methoxyphenoxy)acetamide
Chemical Structure Depiction of
N-(6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3]thiazin-3-yl)-2-(2-methoxyphenoxy)acetamide
N-(6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3]thiazin-3-yl)-2-(2-methoxyphenoxy)acetamide
Compound characteristics
| Compound ID: | G844-0416 |
| Compound Name: | N-(6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3]thiazin-3-yl)-2-(2-methoxyphenoxy)acetamide |
| Molecular Weight: | 320.37 |
| Molecular Formula: | C14 H16 N4 O3 S |
| Smiles: | COc1ccccc1OCC(Nc1nnc2n1CCCS2)=O |
| Stereo: | ACHIRAL |
| logP: | 1.5494 |
| logD: | 1.5492 |
| logSw: | -2.319 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.097 |
| InChI Key: | QKJQDMXIEGWSCI-UHFFFAOYSA-N |