2-(2,1,3-benzothiadiazole-4-sulfonyl)-N-[(2-methoxyphenyl)methyl]acetamide
Chemical Structure Depiction of
2-(2,1,3-benzothiadiazole-4-sulfonyl)-N-[(2-methoxyphenyl)methyl]acetamide
2-(2,1,3-benzothiadiazole-4-sulfonyl)-N-[(2-methoxyphenyl)methyl]acetamide
Compound characteristics
| Compound ID: | G845-0081 |
| Compound Name: | 2-(2,1,3-benzothiadiazole-4-sulfonyl)-N-[(2-methoxyphenyl)methyl]acetamide |
| Molecular Weight: | 377.44 |
| Molecular Formula: | C16 H15 N3 O4 S2 |
| Smiles: | COc1ccccc1CNC(CS(c1cccc2c1nsn2)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2844 |
| logD: | 2.2844 |
| logSw: | -2.5581 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.058 |
| InChI Key: | BSGYUEOMLYEYTA-UHFFFAOYSA-N |