4-methyl-1-[4-(2-methyl-1,3-oxazol-4-yl)benzene-1-sulfonyl]piperidine
Chemical Structure Depiction of
4-methyl-1-[4-(2-methyl-1,3-oxazol-4-yl)benzene-1-sulfonyl]piperidine
4-methyl-1-[4-(2-methyl-1,3-oxazol-4-yl)benzene-1-sulfonyl]piperidine
Compound characteristics
| Compound ID: | G847-0071 |
| Compound Name: | 4-methyl-1-[4-(2-methyl-1,3-oxazol-4-yl)benzene-1-sulfonyl]piperidine |
| Molecular Weight: | 320.41 |
| Molecular Formula: | C16 H20 N2 O3 S |
| Smiles: | CC1CCN(CC1)S(c1ccc(cc1)c1coc(C)n1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2068 |
| logD: | 3.2068 |
| logSw: | -3.4495 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 49.646 |
| InChI Key: | WDMLCQPXSPCUOE-UHFFFAOYSA-N |