N-(2,4-dimethylphenyl)-4-(2-methyl-1,3-oxazol-4-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-4-(2-methyl-1,3-oxazol-4-yl)benzene-1-sulfonamide
N-(2,4-dimethylphenyl)-4-(2-methyl-1,3-oxazol-4-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G847-0096 |
| Compound Name: | N-(2,4-dimethylphenyl)-4-(2-methyl-1,3-oxazol-4-yl)benzene-1-sulfonamide |
| Molecular Weight: | 342.41 |
| Molecular Formula: | C18 H18 N2 O3 S |
| Smiles: | Cc1ccc(c(C)c1)NS(c1ccc(cc1)c1coc(C)n1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1065 |
| logD: | 4.0693 |
| logSw: | -4.1695 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.887 |
| InChI Key: | FRZVSFWKDJFVQD-UHFFFAOYSA-N |