N-{2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl}thiophene-2-sulfonamide
Chemical Structure Depiction of
N-{2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl}thiophene-2-sulfonamide
N-{2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl}thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | G848-0038 |
| Compound Name: | N-{2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl}thiophene-2-sulfonamide |
| Molecular Weight: | 399.92 |
| Molecular Formula: | C16 H18 Cl N3 O3 S2 |
| Smiles: | C(C(N1CCN(CC1)c1ccc(cc1)[Cl])=O)NS(c1cccs1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5027 |
| logD: | 2.5006 |
| logSw: | -3.2797 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.668 |
| InChI Key: | PYFNUXPSOVXBRJ-UHFFFAOYSA-N |