N-[(4-fluorophenyl)methyl]-1-[4-oxo-4-(pyrrolidin-1-yl)butanoyl]-2,3-dihydro-1H-indole-5-sulfonamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-1-[4-oxo-4-(pyrrolidin-1-yl)butanoyl]-2,3-dihydro-1H-indole-5-sulfonamide
N-[(4-fluorophenyl)methyl]-1-[4-oxo-4-(pyrrolidin-1-yl)butanoyl]-2,3-dihydro-1H-indole-5-sulfonamide
Compound characteristics
| Compound ID: | G851-0490 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-1-[4-oxo-4-(pyrrolidin-1-yl)butanoyl]-2,3-dihydro-1H-indole-5-sulfonamide |
| Molecular Weight: | 459.54 |
| Molecular Formula: | C23 H26 F N3 O4 S |
| Smiles: | C1CCN(C1)C(CCC(N1CCc2cc(ccc12)S(NCc1ccc(cc1)F)(=O)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5403 |
| logD: | 2.5399 |
| logSw: | -2.9522 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.907 |
| InChI Key: | RWFPGAMFWAACQN-UHFFFAOYSA-N |