N-(3,5-dimethylphenyl)-N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]urea
Chemical Structure Depiction of
N-(3,5-dimethylphenyl)-N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]urea
N-(3,5-dimethylphenyl)-N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]urea
Compound characteristics
| Compound ID: | G851-0638 |
| Compound Name: | N-(3,5-dimethylphenyl)-N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]urea |
| Molecular Weight: | 322.36 |
| Molecular Formula: | C18 H18 N4 O2 |
| Smiles: | Cc1cc(C)cc(c1)NC(Nc1ccc(cc1)c1nc(C)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6957 |
| logD: | 4.6957 |
| logSw: | -4.4197 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.447 |
| InChI Key: | QIEKVLPXRFEARM-UHFFFAOYSA-N |