3-{[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methyl}-1,2,3-benzotriazin-4(3H)-one
Chemical Structure Depiction of
3-{[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methyl}-1,2,3-benzotriazin-4(3H)-one
3-{[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methyl}-1,2,3-benzotriazin-4(3H)-one
Compound characteristics
| Compound ID: | G851-0706 |
| Compound Name: | 3-{[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methyl}-1,2,3-benzotriazin-4(3H)-one |
| Molecular Weight: | 339.74 |
| Molecular Formula: | C16 H10 Cl N5 O2 |
| Smiles: | C(c1nc(c2ccc(cc2)[Cl])on1)N1C(c2ccccc2N=N1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4914 |
| logD: | 3.4914 |
| logSw: | -4.149 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 73.601 |
| InChI Key: | SJXLZZOFQBSXSR-UHFFFAOYSA-N |