N-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-N'-[3-(methylsulfanyl)phenyl]urea
Chemical Structure Depiction of
N-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-N'-[3-(methylsulfanyl)phenyl]urea
N-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-N'-[3-(methylsulfanyl)phenyl]urea
Compound characteristics
| Compound ID: | G851-0806 |
| Compound Name: | N-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-N'-[3-(methylsulfanyl)phenyl]urea |
| Molecular Weight: | 340.4 |
| Molecular Formula: | C17 H16 N4 O2 S |
| Smiles: | Cc1nc(c2cccc(c2)NC(Nc2cccc(c2)SC)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.7627 |
| logD: | 4.7627 |
| logSw: | -4.5644 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.447 |
| InChI Key: | OMHINYNTXUSZBR-UHFFFAOYSA-N |