N-[(4-chlorophenyl)methyl]-2-[6-(4-methylpiperidine-1-sulfonyl)-2-oxoquinolin-1(2H)-yl]acetamide
Chemical Structure Depiction of
N-[(4-chlorophenyl)methyl]-2-[6-(4-methylpiperidine-1-sulfonyl)-2-oxoquinolin-1(2H)-yl]acetamide
N-[(4-chlorophenyl)methyl]-2-[6-(4-methylpiperidine-1-sulfonyl)-2-oxoquinolin-1(2H)-yl]acetamide
Compound characteristics
| Compound ID: | G853-0166 |
| Compound Name: | N-[(4-chlorophenyl)methyl]-2-[6-(4-methylpiperidine-1-sulfonyl)-2-oxoquinolin-1(2H)-yl]acetamide |
| Molecular Weight: | 488 |
| Molecular Formula: | C24 H26 Cl N3 O4 S |
| Smiles: | CC1CCN(CC1)S(c1ccc2c(C=CC(N2CC(NCc2ccc(cc2)[Cl])=O)=O)c1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.665 |
| logD: | 3.665 |
| logSw: | -4.1858 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.801 |
| InChI Key: | LWYGTJRTASCSFA-UHFFFAOYSA-N |