4-(azepane-1-sulfonyl)-N-[2-(1,3-benzothiazol-2-yl)phenyl]benzamide
Chemical Structure Depiction of
4-(azepane-1-sulfonyl)-N-[2-(1,3-benzothiazol-2-yl)phenyl]benzamide
4-(azepane-1-sulfonyl)-N-[2-(1,3-benzothiazol-2-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | G856-0126 |
| Compound Name: | 4-(azepane-1-sulfonyl)-N-[2-(1,3-benzothiazol-2-yl)phenyl]benzamide |
| Molecular Weight: | 491.63 |
| Molecular Formula: | C26 H25 N3 O3 S2 |
| Smiles: | C1CCCN(CC1)S(c1ccc(cc1)C(Nc1ccccc1c1nc2ccccc2s1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.627 |
| logD: | 5.6268 |
| logSw: | -5.6964 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.123 |
| InChI Key: | MAPSQKTXAGZGLK-UHFFFAOYSA-N |