2-{[(3,4-dichlorophenyl)methyl]sulfanyl}-3-methyl-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
Chemical Structure Depiction of
2-{[(3,4-dichlorophenyl)methyl]sulfanyl}-3-methyl-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
2-{[(3,4-dichlorophenyl)methyl]sulfanyl}-3-methyl-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
Compound characteristics
| Compound ID: | G856-0809 |
| Compound Name: | 2-{[(3,4-dichlorophenyl)methyl]sulfanyl}-3-methyl-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one |
| Molecular Weight: | 390.29 |
| Molecular Formula: | C18 H13 Cl2 N3 O S |
| Smiles: | CN1C(=Nc2c3ccccc3[nH]c2C1=O)SCc1ccc(c(c1)[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.6558 |
| logD: | 4.6558 |
| logSw: | -4.8003 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.766 |
| InChI Key: | LTXRDSOJLISFAA-UHFFFAOYSA-N |