N-(2-fluorophenyl)-2-{[3-(4-fluorophenyl)-4-oxo-4,5-dihydro-3H-pyrimido[5,4-b]indol-2-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-(2-fluorophenyl)-2-{[3-(4-fluorophenyl)-4-oxo-4,5-dihydro-3H-pyrimido[5,4-b]indol-2-yl]sulfanyl}acetamide
N-(2-fluorophenyl)-2-{[3-(4-fluorophenyl)-4-oxo-4,5-dihydro-3H-pyrimido[5,4-b]indol-2-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | G856-1141 |
| Compound Name: | N-(2-fluorophenyl)-2-{[3-(4-fluorophenyl)-4-oxo-4,5-dihydro-3H-pyrimido[5,4-b]indol-2-yl]sulfanyl}acetamide |
| Molecular Weight: | 462.48 |
| Molecular Formula: | C24 H16 F2 N4 O2 S |
| Smiles: | C(C(Nc1ccccc1F)=O)SC1=Nc2c3ccccc3[nH]c2C(N1c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8571 |
| logD: | 3.8571 |
| logSw: | -4.306 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.569 |
| InChI Key: | RJJWASPTSWWNSN-UHFFFAOYSA-N |