3-(4-fluorophenyl)-2-{[(2-fluorophenyl)methyl]sulfanyl}-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
Chemical Structure Depiction of
3-(4-fluorophenyl)-2-{[(2-fluorophenyl)methyl]sulfanyl}-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
3-(4-fluorophenyl)-2-{[(2-fluorophenyl)methyl]sulfanyl}-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
Compound characteristics
| Compound ID: | G856-1182 |
| Compound Name: | 3-(4-fluorophenyl)-2-{[(2-fluorophenyl)methyl]sulfanyl}-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one |
| Molecular Weight: | 419.45 |
| Molecular Formula: | C23 H15 F2 N3 O S |
| Smiles: | C(c1ccccc1F)SC1=Nc2c3ccccc3[nH]c2C(N1c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9657 |
| logD: | 4.9657 |
| logSw: | -5.1497 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.118 |
| InChI Key: | QRKVNKMWRPHMJL-UHFFFAOYSA-N |