2-methoxy-6-methyl-4-phenylquinazoline
Chemical Structure Depiction of
2-methoxy-6-methyl-4-phenylquinazoline
2-methoxy-6-methyl-4-phenylquinazoline
Compound characteristics
| Compound ID: | G856-2385 |
| Compound Name: | 2-methoxy-6-methyl-4-phenylquinazoline |
| Molecular Weight: | 250.3 |
| Molecular Formula: | C16 H14 N2 O |
| Smiles: | Cc1ccc2c(c1)c(c1ccccc1)nc(n2)OC |
| Stereo: | ACHIRAL |
| logP: | 4.286 |
| logD: | 4.286 |
| logSw: | -4.4859 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 26.3681 |
| InChI Key: | DTUSRJSYXKDFQF-UHFFFAOYSA-N |