N~1~-(3-methoxyphenyl)-N~2~-[2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethyl]ethanediamide
Chemical Structure Depiction of
N~1~-(3-methoxyphenyl)-N~2~-[2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethyl]ethanediamide
N~1~-(3-methoxyphenyl)-N~2~-[2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethyl]ethanediamide
Compound characteristics
| Compound ID: | G856-2930 |
| Compound Name: | N~1~-(3-methoxyphenyl)-N~2~-[2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethyl]ethanediamide |
| Molecular Weight: | 395.48 |
| Molecular Formula: | C21 H21 N3 O3 S |
| Smiles: | Cc1c(CCNC(C(Nc2cccc(c2)OC)=O)=O)sc(c2ccccc2)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.6616 |
| logD: | 3.159 |
| logSw: | -4.135 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.711 |
| InChI Key: | ASLWBNPTJABEGX-UHFFFAOYSA-N |