N-(2,4-dimethylphenyl)-2-[(3-methyl-4-oxo-4H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]acetamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-2-[(3-methyl-4-oxo-4H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]acetamide
N-(2,4-dimethylphenyl)-2-[(3-methyl-4-oxo-4H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]acetamide
Compound characteristics
| Compound ID: | G856-3750 |
| Compound Name: | N-(2,4-dimethylphenyl)-2-[(3-methyl-4-oxo-4H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]acetamide |
| Molecular Weight: | 361.44 |
| Molecular Formula: | C15 H15 N5 O2 S2 |
| Smiles: | CC1C(N2C(=NN=1)SC(=N2)SCC(Nc1ccc(C)cc1C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0529 |
| logD: | 3.0492 |
| logSw: | -3.0913 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.141 |
| InChI Key: | ZKELVERDDKVAHK-UHFFFAOYSA-N |