N-(4-acetylphenyl)-2-[(3-methyl-4-oxo-4H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]acetamide
					Chemical Structure Depiction of
N-(4-acetylphenyl)-2-[(3-methyl-4-oxo-4H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]acetamide
			N-(4-acetylphenyl)-2-[(3-methyl-4-oxo-4H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]acetamide
Compound characteristics
| Compound ID: | G856-3780 | 
| Compound Name: | N-(4-acetylphenyl)-2-[(3-methyl-4-oxo-4H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]acetamide | 
| Molecular Weight: | 375.43 | 
| Molecular Formula: | C15 H13 N5 O3 S2 | 
| Smiles: | CC1C(N2C(=NN=1)SC(=N2)SCC(Nc1ccc(cc1)C(C)=O)=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 2.1124 | 
| logD: | 2.1085 | 
| logSw: | -2.7046 | 
| Hydrogen bond acceptors count: | 11 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 84.665 | 
| InChI Key: | GXPHSGSKXKUFPE-UHFFFAOYSA-N | 
 
				 
				