N-{2-(2H-1,3-benzodioxol-5-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl}furan-2-carboxamide
Chemical Structure Depiction of
N-{2-(2H-1,3-benzodioxol-5-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl}furan-2-carboxamide
N-{2-(2H-1,3-benzodioxol-5-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl}furan-2-carboxamide
Compound characteristics
| Compound ID: | G856-4249 |
| Compound Name: | N-{2-(2H-1,3-benzodioxol-5-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl}furan-2-carboxamide |
| Molecular Weight: | 449.51 |
| Molecular Formula: | C25 H27 N3 O5 |
| Smiles: | COc1ccc(cc1)N1CCN(CC1)C(CNC(c1ccco1)=O)c1ccc2c(c1)OCO2 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.377 |
| logD: | 3.3213 |
| logSw: | -3.58 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.139 |
| InChI Key: | RYZOSFBPAZVGKQ-NRFANRHFSA-N |