N~1~-(2-methoxyethyl)-N~2~-[2-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]ethanediamide
Chemical Structure Depiction of
N~1~-(2-methoxyethyl)-N~2~-[2-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]ethanediamide
N~1~-(2-methoxyethyl)-N~2~-[2-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]ethanediamide
Compound characteristics
| Compound ID: | G856-4360 |
| Compound Name: | N~1~-(2-methoxyethyl)-N~2~-[2-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]ethanediamide |
| Molecular Weight: | 410.51 |
| Molecular Formula: | C18 H22 N2 O5 S2 |
| Smiles: | Cc1ccc(cc1)S(C(CNC(C(NCCOC)=O)=O)c1cccs1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.4688 |
| logD: | 1.4624 |
| logSw: | -2.3067 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 88.311 |
| InChI Key: | HREZLXQTJVQEBU-INIZCTEOSA-N |