3-chloro-N-[2-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]benzamide
Chemical Structure Depiction of
3-chloro-N-[2-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]benzamide
3-chloro-N-[2-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]benzamide
Compound characteristics
| Compound ID: | G856-4382 |
| Compound Name: | 3-chloro-N-[2-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]benzamide |
| Molecular Weight: | 419.95 |
| Molecular Formula: | C20 H18 Cl N O3 S2 |
| Smiles: | Cc1ccc(cc1)S(C(CNC(c1cccc(c1)[Cl])=O)c1cccs1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3899 |
| logD: | 4.3898 |
| logSw: | -4.5957 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.171 |
| InChI Key: | BEAJXUMUXWSSJA-IBGZPJMESA-N |