N~1~-[2-(1H-indol-3-yl)ethyl]-N~2~-[2-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]ethanediamide
Chemical Structure Depiction of
N~1~-[2-(1H-indol-3-yl)ethyl]-N~2~-[2-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]ethanediamide
N~1~-[2-(1H-indol-3-yl)ethyl]-N~2~-[2-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]ethanediamide
Compound characteristics
| Compound ID: | G856-4386 |
| Compound Name: | N~1~-[2-(1H-indol-3-yl)ethyl]-N~2~-[2-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]ethanediamide |
| Molecular Weight: | 495.62 |
| Molecular Formula: | C25 H25 N3 O4 S2 |
| Smiles: | Cc1ccc(cc1)S(C(CNC(C(NCCc1c[nH]c2ccccc12)=O)=O)c1cccs1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2608 |
| logD: | 3.2546 |
| logSw: | -3.4473 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 89.568 |
| InChI Key: | MYZDALSHVAYBAI-QHCPKHFHSA-N |