(2-fluorophenyl)[4-(2,4,6-trimethylbenzene-1-sulfonyl)-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]methanone
Chemical Structure Depiction of
(2-fluorophenyl)[4-(2,4,6-trimethylbenzene-1-sulfonyl)-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]methanone
(2-fluorophenyl)[4-(2,4,6-trimethylbenzene-1-sulfonyl)-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]methanone
Compound characteristics
| Compound ID: | G856-4769 |
| Compound Name: | (2-fluorophenyl)[4-(2,4,6-trimethylbenzene-1-sulfonyl)-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]methanone |
| Molecular Weight: | 446.54 |
| Molecular Formula: | C23 H27 F N2 O4 S |
| Smiles: | Cc1cc(C)c(c(C)c1)S(N1CCOC12CCN(CC2)C(c1ccccc1F)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5229 |
| logD: | 3.5229 |
| logSw: | -3.6977 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 55.576 |
| InChI Key: | UDZLAPCEYGAPKC-UHFFFAOYSA-N |