(2-chloro-6-fluorophenyl)[4-(thiophene-2-sulfonyl)-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]methanone
Chemical Structure Depiction of
(2-chloro-6-fluorophenyl)[4-(thiophene-2-sulfonyl)-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]methanone
(2-chloro-6-fluorophenyl)[4-(thiophene-2-sulfonyl)-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]methanone
Compound characteristics
| Compound ID: | G856-4887 |
| Compound Name: | (2-chloro-6-fluorophenyl)[4-(thiophene-2-sulfonyl)-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]methanone |
| Molecular Weight: | 444.93 |
| Molecular Formula: | C18 H18 Cl F N2 O4 S2 |
| Smiles: | C1CN(CCC12N(CCO2)S(c1cccs1)(=O)=O)C(c1c(cccc1[Cl])F)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3227 |
| logD: | 2.3227 |
| logSw: | -3.2672 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 56.594 |
| InChI Key: | RSGDLHOZCGTOFD-UHFFFAOYSA-N |