N-[2-(2-phenyl[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethyl]benzenesulfonamide
Chemical Structure Depiction of
N-[2-(2-phenyl[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethyl]benzenesulfonamide
N-[2-(2-phenyl[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethyl]benzenesulfonamide
Compound characteristics
| Compound ID: | G856-4993 |
| Compound Name: | N-[2-(2-phenyl[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethyl]benzenesulfonamide |
| Molecular Weight: | 384.48 |
| Molecular Formula: | C18 H16 N4 O2 S2 |
| Smiles: | C(CNS(c1ccccc1)(=O)=O)c1csc2nc(c3ccccc3)nn12 |
| Stereo: | ACHIRAL |
| logP: | 3.6724 |
| logD: | 3.6724 |
| logSw: | -4.0022 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.043 |
| InChI Key: | CRKUWAQMUOUMJA-UHFFFAOYSA-N |