N~1~-[2-(4-chlorobenzene-1-sulfonyl)-2-(furan-2-yl)ethyl]-N~2~-[(2-methylphenyl)methyl]ethanediamide
Chemical Structure Depiction of
N~1~-[2-(4-chlorobenzene-1-sulfonyl)-2-(furan-2-yl)ethyl]-N~2~-[(2-methylphenyl)methyl]ethanediamide
N~1~-[2-(4-chlorobenzene-1-sulfonyl)-2-(furan-2-yl)ethyl]-N~2~-[(2-methylphenyl)methyl]ethanediamide
Compound characteristics
| Compound ID: | G856-5374 |
| Compound Name: | N~1~-[2-(4-chlorobenzene-1-sulfonyl)-2-(furan-2-yl)ethyl]-N~2~-[(2-methylphenyl)methyl]ethanediamide |
| Molecular Weight: | 460.94 |
| Molecular Formula: | C22 H21 Cl N2 O5 S |
| Smiles: | Cc1ccccc1CNC(C(NCC(c1ccco1)S(c1ccc(cc1)[Cl])(=O)=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.612 |
| logD: | 3.4734 |
| logSw: | -3.9125 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 87.416 |
| InChI Key: | QNVYZMQZKUUUMQ-FQEVSTJZSA-N |