5-{[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methyl}-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione
Chemical Structure Depiction of
5-{[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methyl}-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione
5-{[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methyl}-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione
Compound characteristics
| Compound ID: | G856-6159 |
| Compound Name: | 5-{[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methyl}-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione |
| Molecular Weight: | 267.37 |
| Molecular Formula: | C10 H13 N5 S2 |
| Smiles: | Cc1cc(C)nc(n1)SCC1=NNC(N1C)=S |
| Stereo: | ACHIRAL |
| logP: | 1.6069 |
| logD: | 1.2767 |
| logSw: | -1.8045 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.384 |
| InChI Key: | VJBYYOULDRUOEC-UHFFFAOYSA-N |