1-(2,5-dimethoxyphenyl)-2-[3-(dimethylamino)propyl]-7-methyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Chemical Structure Depiction of
1-(2,5-dimethoxyphenyl)-2-[3-(dimethylamino)propyl]-7-methyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
1-(2,5-dimethoxyphenyl)-2-[3-(dimethylamino)propyl]-7-methyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Compound characteristics
| Compound ID: | G856-6193 |
| Compound Name: | 1-(2,5-dimethoxyphenyl)-2-[3-(dimethylamino)propyl]-7-methyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione |
| Molecular Weight: | 436.51 |
| Molecular Formula: | C25 H28 N2 O5 |
| Smiles: | Cc1ccc2c(c1)C(C1C(c3cc(ccc3OC)OC)N(CCCN(C)C)C(C=1O2)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3912 |
| logD: | 1.4424 |
| logSw: | -3.7369 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 56.023 |
| InChI Key: | OMTXJQUPLRWQGK-JOCHJYFZSA-N |