3-(4-methoxyphenyl)-4-methyl-2-oxo-2H-1-benzopyran-6-yl acetate
Chemical Structure Depiction of
3-(4-methoxyphenyl)-4-methyl-2-oxo-2H-1-benzopyran-6-yl acetate
3-(4-methoxyphenyl)-4-methyl-2-oxo-2H-1-benzopyran-6-yl acetate
Compound characteristics
| Compound ID: | G856-6259 |
| Compound Name: | 3-(4-methoxyphenyl)-4-methyl-2-oxo-2H-1-benzopyran-6-yl acetate |
| Molecular Weight: | 324.33 |
| Molecular Formula: | C19 H16 O5 |
| Smiles: | CC1=C(C(=O)Oc2ccc(cc12)OC(C)=O)c1ccc(cc1)OC |
| Stereo: | ACHIRAL |
| logP: | 3.2917 |
| logD: | 3.2917 |
| logSw: | -3.5827 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 49.183 |
| InChI Key: | ZFNOJZNFYHZDEZ-UHFFFAOYSA-N |