3-[(butan-2-yl)sulfanyl]-5-propyl[1,2,4]triazolo[4,3-a]pyrimidin-7(8H)-one
Chemical Structure Depiction of
3-[(butan-2-yl)sulfanyl]-5-propyl[1,2,4]triazolo[4,3-a]pyrimidin-7(8H)-one
3-[(butan-2-yl)sulfanyl]-5-propyl[1,2,4]triazolo[4,3-a]pyrimidin-7(8H)-one
Compound characteristics
| Compound ID: | G856-6854 |
| Compound Name: | 3-[(butan-2-yl)sulfanyl]-5-propyl[1,2,4]triazolo[4,3-a]pyrimidin-7(8H)-one |
| Molecular Weight: | 266.36 |
| Molecular Formula: | C12 H18 N4 O S |
| Smiles: | CCCC1=CC(Nc2nnc(n12)SC(C)CC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6726 |
| logD: | 2.6451 |
| logSw: | -2.9342 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.33 |
| InChI Key: | KXIVBAYHDWEVFX-QMMMGPOBSA-N |