N-[(3-methoxyphenyl)methyl]-2-[(6-methyl-2-oxo-1,2-dihydropyrimidin-4-yl)sulfanyl]acetamide
Chemical Structure Depiction of
N-[(3-methoxyphenyl)methyl]-2-[(6-methyl-2-oxo-1,2-dihydropyrimidin-4-yl)sulfanyl]acetamide
N-[(3-methoxyphenyl)methyl]-2-[(6-methyl-2-oxo-1,2-dihydropyrimidin-4-yl)sulfanyl]acetamide
Compound characteristics
| Compound ID: | G856-8152 |
| Compound Name: | N-[(3-methoxyphenyl)methyl]-2-[(6-methyl-2-oxo-1,2-dihydropyrimidin-4-yl)sulfanyl]acetamide |
| Molecular Weight: | 319.38 |
| Molecular Formula: | C15 H17 N3 O3 S |
| Smiles: | CC1=CC(=NC(N1)=O)SCC(NCc1cccc(c1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 1.4392 |
| logD: | 1.3754 |
| logSw: | -2.3486 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.095 |
| InChI Key: | RYQROMFXRQMDFS-UHFFFAOYSA-N |