N-{2-[2-(4-methoxyphenyl)-6-methyl[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]ethyl}-4-phenylbutanamide
Chemical Structure Depiction of
N-{2-[2-(4-methoxyphenyl)-6-methyl[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]ethyl}-4-phenylbutanamide
N-{2-[2-(4-methoxyphenyl)-6-methyl[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]ethyl}-4-phenylbutanamide
Compound characteristics
| Compound ID: | G856-8293 |
| Compound Name: | N-{2-[2-(4-methoxyphenyl)-6-methyl[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]ethyl}-4-phenylbutanamide |
| Molecular Weight: | 434.56 |
| Molecular Formula: | C24 H26 N4 O2 S |
| Smiles: | Cc1c(CCNC(CCCc2ccccc2)=O)sc2nc(c3ccc(cc3)OC)nn12 |
| Stereo: | ACHIRAL |
| logP: | 4.4861 |
| logD: | 4.4861 |
| logSw: | -4.389 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.294 |
| InChI Key: | OMRBNQCWDCICPD-UHFFFAOYSA-N |