{4-[6-(benzylamino)pyridazin-3-yl]piperazin-1-yl}(3,4-dimethylphenyl)methanone
Chemical Structure Depiction of
{4-[6-(benzylamino)pyridazin-3-yl]piperazin-1-yl}(3,4-dimethylphenyl)methanone
{4-[6-(benzylamino)pyridazin-3-yl]piperazin-1-yl}(3,4-dimethylphenyl)methanone
Compound characteristics
| Compound ID: | G856-8741 |
| Compound Name: | {4-[6-(benzylamino)pyridazin-3-yl]piperazin-1-yl}(3,4-dimethylphenyl)methanone |
| Molecular Weight: | 401.51 |
| Molecular Formula: | C24 H27 N5 O |
| Smiles: | Cc1ccc(cc1C)C(N1CCN(CC1)c1ccc(NCc2ccccc2)nn1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9159 |
| logD: | 3.9086 |
| logSw: | -3.9437 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.155 |
| InChI Key: | UCAUXCYXELXXDO-UHFFFAOYSA-N |