1-[4-(4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one
Chemical Structure Depiction of
1-[4-(4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one
1-[4-(4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one
Compound characteristics
| Compound ID: | G856-9047 |
| Compound Name: | 1-[4-(4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one |
| Molecular Weight: | 365.5 |
| Molecular Formula: | C21 H23 N3 O S |
| Smiles: | Cc1cccc2c1nc(N1CCN(CC1)C(CCc1ccccc1)=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 4.5838 |
| logD: | 4.5836 |
| logSw: | -4.4589 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 29.9255 |
| InChI Key: | CMYNUEWKLFHWNC-UHFFFAOYSA-N |