1-[4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one
Chemical Structure Depiction of
1-[4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one
1-[4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one
Compound characteristics
| Compound ID: | G856-9492 |
| Compound Name: | 1-[4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one |
| Molecular Weight: | 379.52 |
| Molecular Formula: | C22 H25 N3 O S |
| Smiles: | Cc1ccc2c(c1C)nc(N1CCN(CC1)C(CCc1ccccc1)=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 5.0345 |
| logD: | 5.0344 |
| logSw: | -4.6418 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 29.9255 |
| InChI Key: | JTUWKNGOZOIPGX-UHFFFAOYSA-N |