(1,3-benzothiazol-2-yl)[4-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone
Chemical Structure Depiction of
(1,3-benzothiazol-2-yl)[4-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone
(1,3-benzothiazol-2-yl)[4-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | G856-9506 |
| Compound Name: | (1,3-benzothiazol-2-yl)[4-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone |
| Molecular Weight: | 428.96 |
| Molecular Formula: | C20 H17 Cl N4 O S2 |
| Smiles: | Cc1c(ccc2c1nc(N1CCN(CC1)C(c1nc3ccccc3s1)=O)s2)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.3503 |
| logD: | 5.3502 |
| logSw: | -5.7899 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 40.173 |
| InChI Key: | LCXGLGLNVAWUSE-UHFFFAOYSA-N |