1-[4-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]butan-1-one
Chemical Structure Depiction of
1-[4-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]butan-1-one
1-[4-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]butan-1-one
Compound characteristics
| Compound ID: | G856-9509 |
| Compound Name: | 1-[4-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]butan-1-one |
| Molecular Weight: | 337.87 |
| Molecular Formula: | C16 H20 Cl N3 O S |
| Smiles: | CCCC(N1CCN(CC1)c1nc2c(C)c(ccc2s1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.2476 |
| logD: | 4.2474 |
| logSw: | -4.4074 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 30.197 |
| InChI Key: | HRLJLVAMIAMXKI-UHFFFAOYSA-N |