N-(2-fluorophenyl)-1-[(4-methylphenyl)methyl]-2-oxo-1,2-dihydropyridine-3-carboxamide
Chemical Structure Depiction of
N-(2-fluorophenyl)-1-[(4-methylphenyl)methyl]-2-oxo-1,2-dihydropyridine-3-carboxamide
N-(2-fluorophenyl)-1-[(4-methylphenyl)methyl]-2-oxo-1,2-dihydropyridine-3-carboxamide
Compound characteristics
| Compound ID: | G857-0667 |
| Compound Name: | N-(2-fluorophenyl)-1-[(4-methylphenyl)methyl]-2-oxo-1,2-dihydropyridine-3-carboxamide |
| Molecular Weight: | 336.36 |
| Molecular Formula: | C20 H17 F N2 O2 |
| Smiles: | Cc1ccc(CN2C=CC=C(C(Nc3ccccc3F)=O)C2=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.2468 |
| logD: | 2.4794 |
| logSw: | -3.3137 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.346 |
| InChI Key: | POPPVAMEKVHCJQ-UHFFFAOYSA-N |